C20H17F3N4O3S — CID 155857087
pyridin-2-yl-(4-thiophen-3-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155857087) has the molecular formula C20H17F3N4O3S and a molecular weight of 450.44 g/mol. Its IUPAC name is pyridin-2-yl-(4-thiophen-3-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | pyridin-2-yl-(4-thiophen-3-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155857087 |
| Molecular Formula | C20H17F3N4O3S |
| Molecular Weight | 450.44 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | pyridin-2-yl-(4-thiophen-3-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccccn1)N1CCc2ncnc(-c3ccsc3)c2CC1 |
| InChI | InChI=1S/C18H16N4OS.C2HF3O2/c23-18(16-3-1-2-7-19-16)22-8-4-14-15(5-9-22)20-12-21-17(14)13-6-10-24-11-13;3-2(4,5)1(6)7/h1-3,6-7,10-12H,4-5,8-9H2;(H,6,7) |
| InChIKey | FIWGBXTWEGRWTP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |