C18H21F3N4O4 — CID 155850173
[4-[ethyl(methyl)amino]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(furan-3-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155850173) has the molecular formula C18H21F3N4O4 and a molecular weight of 414.38 g/mol. Its IUPAC name is [4-[ethyl(methyl)amino]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(furan-3-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [4-[ethyl(methyl)amino]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(furan-3-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155850173 |
| Molecular Formula | C18H21F3N4O4 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | [4-[ethyl(methyl)amino]-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(furan-3-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | CCN(C)c1ncnc2c1CCN(C(=O)c1ccoc1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H20N4O2.C2HF3O2/c1-3-19(2)15-13-4-7-20(8-5-14(13)17-11-18-15)16(21)12-6-9-22-10-12;3-2(4,5)1(6)7/h6,9-11H,3-5,7-8H2,1-2H3;(H,6,7) |
| InChIKey | OSIZBNBQQQBOJR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |