C18H27F3N4O3 — CID 155857079
N-ethyl-N-methyl-7-(oxan-4-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;2,2,2-trifluoroacetic acid (PubChem CID 155857079) has the molecular formula C18H27F3N4O3 and a molecular weight of 404.43 g/mol. Its IUPAC name is N-ethyl-N-methyl-7-(oxan-4-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;2,2,2-trifluoroacetic acid.
| Compound Name | N-ethyl-N-methyl-7-(oxan-4-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155857079 |
| Molecular Formula | C18H27F3N4O3 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.20 |
| IUPAC Name | N-ethyl-N-methyl-7-(oxan-4-yl)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;2,2,2-trifluoroacetic acid |
| SMILES | CCN(C)c1ncnc2c1CCN(C1CCOCC1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H26N4O.C2HF3O2/c1-3-19(2)16-14-4-8-20(13-6-10-21-11-7-13)9-5-15(14)17-12-18-16;3-2(4,5)1(6)7/h12-13H,3-11H2,1-2H3;(H,6,7) |
| InChIKey | WKYYKUHVOGQQLA-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |