C17H22F4N4O3 — CID 155867262
[4-(dimethylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(3-fluorocyclobutyl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155867262) has the molecular formula C17H22F4N4O3 and a molecular weight of 406.38 g/mol. Its IUPAC name is [4-(dimethylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(3-fluorocyclobutyl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [4-(dimethylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(3-fluorocyclobutyl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155867262 |
| Molecular Formula | C17H22F4N4O3 |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | [4-(dimethylamino)-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl]-(3-fluorocyclobutyl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)c1ncnc2c1CCN(C(=O)C1CC(F)C1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H21FN4O.C2HF3O2/c1-19(2)14-12-3-5-20(6-4-13(12)17-9-18-14)15(21)10-7-11(16)8-10;3-2(4,5)1(6)7/h9-11H,3-8H2,1-2H3;(H,6,7) |
| InChIKey | NSQZENXEIARWQT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |