C18H21F3N6O3 — CID 118742823
2-(dimethylamino)-1-(4-pyrimidin-5-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)ethanone;2,2,2-trifluoroacetic acid (PubChem CID 118742823) has the molecular formula C18H21F3N6O3 and a molecular weight of 426.40 g/mol. Its IUPAC name is 2-(dimethylamino)-1-(4-pyrimidin-5-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)ethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(dimethylamino)-1-(4-pyrimidin-5-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)ethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118742823 |
| Molecular Formula | C18H21F3N6O3 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 2-(dimethylamino)-1-(4-pyrimidin-5-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-7-yl)ethanone;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)CC(=O)N1CCc2ncnc(-c3cncnc3)c2CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H20N6O.C2HF3O2/c1-21(2)9-15(23)22-5-3-13-14(4-6-22)19-11-20-16(13)12-7-17-10-18-8-12;3-2(4,5)1(6)7/h7-8,10-11H,3-6,9H2,1-2H3;(H,6,7) |
| InChIKey | UMCLASHYZHFQFP-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |