C19H27F6N5O6S — CID 155869459
N,N-dimethyl-7-methylsulfonyl-2-pyrrolidin-1-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155869459) has the molecular formula C19H27F6N5O6S and a molecular weight of 567.51 g/mol. Its IUPAC name is N,N-dimethyl-7-methylsulfonyl-2-pyrrolidin-1-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | N,N-dimethyl-7-methylsulfonyl-2-pyrrolidin-1-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155869459 |
| Molecular Formula | C19H27F6N5O6S |
| Molecular Weight | 567.51 g/mol |
| Exact Mass | 567.16 |
| IUPAC Name | N,N-dimethyl-7-methylsulfonyl-2-pyrrolidin-1-yl-5,6,8,9-tetrahydropyrimido[4,5-d]azepin-4-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)c1nc(N2CCCC2)nc2c1CCN(S(C)(=O)=O)CC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H25N5O2S.2C2HF3O2/c1-18(2)14-12-6-10-20(23(3,21)22)11-7-13(12)16-15(17-14)19-8-4-5-9-19;2*3-2(4,5)1(6)7/h4-11H2,1-3H3;2*(H,6,7) |
| InChIKey | GHTVBASLWASOBB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 144.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.51 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |