C17H22F3N5O3S — CID 155849666
N,N-dimethyl-6-[(1-methylimidazol-2-yl)methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155849666) has the molecular formula C17H22F3N5O3S and a molecular weight of 433.46 g/mol. Its IUPAC name is N,N-dimethyl-6-[(1-methylimidazol-2-yl)methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N,N-dimethyl-6-[(1-methylimidazol-2-yl)methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155849666 |
| Molecular Formula | C17H22F3N5O3S |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N,N-dimethyl-6-[(1-methylimidazol-2-yl)methyl]-4,5,7,8-tetrahydro-[1,3]thiazolo[4,5-d]azepine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)c1nc2c(s1)CCN(Cc1nccn1C)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H21N5OS.C2HF3O2/c1-18(2)15(21)14-17-11-4-7-20(8-5-12(11)22-14)10-13-16-6-9-19(13)3;3-2(4,5)1(6)7/h6,9H,4-5,7-8,10H2,1-3H3;(H,6,7) |
| InChIKey | NSACRWPXASOSKM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |