C23H32F6N4O5 — CID 118745863
7-(cyclopropylmethyl)-N-methyl-2-(2-methylpropylamino)-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 118745863) has the molecular formula C23H32F6N4O5 and a molecular weight of 558.52 g/mol. Its IUPAC name is 7-(cyclopropylmethyl)-N-methyl-2-(2-methylpropylamino)-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 7-(cyclopropylmethyl)-N-methyl-2-(2-methylpropylamino)-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118745863 |
| Molecular Formula | C23H32F6N4O5 |
| Molecular Weight | 558.52 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 7-(cyclopropylmethyl)-N-methyl-2-(2-methylpropylamino)-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CNC(=O)c1cc2c(nc1NCC(C)C)CCN(CC1CC1)CC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H30N4O.2C2HF3O2/c1-13(2)11-21-18-16(19(24)20-3)10-15-6-8-23(12-14-4-5-14)9-7-17(15)22-18;2*3-2(4,5)1(6)7/h10,13-14H,4-9,11-12H2,1-3H3,(H,20,24)(H,21,22);2*(H,6,7) |
| InChIKey | WPCULFUXODYAIF-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 131.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |