C20H28F3N5O4 — CID 155826441
3-N-(cyclopropylmethyl)-2-(dimethylamino)-7-N-methyl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3,7-dicarboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155826441) has the molecular formula C20H28F3N5O4 and a molecular weight of 459.47 g/mol. Its IUPAC name is 3-N-(cyclopropylmethyl)-2-(dimethylamino)-7-N-methyl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3,7-dicarboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-N-(cyclopropylmethyl)-2-(dimethylamino)-7-N-methyl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3,7-dicarboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826441 |
| Molecular Formula | C20H28F3N5O4 |
| Molecular Weight | 459.47 g/mol |
| Exact Mass | 459.21 |
| IUPAC Name | 3-N-(cyclopropylmethyl)-2-(dimethylamino)-7-N-methyl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3,7-dicarboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CNC(=O)N1CCc2cc(C(=O)NCC3CC3)c(N(C)C)nc2CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H27N5O2.C2HF3O2/c1-19-18(25)23-8-6-13-10-14(17(24)20-11-12-4-5-12)16(22(2)3)21-15(13)7-9-23;3-2(4,5)1(6)7/h10,12H,4-9,11H2,1-3H3,(H,19,25)(H,20,24);(H,6,7) |
| InChIKey | CWPMAXLWNFUOTO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.47 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |