C27H32F6N4O5 — CID 155840130
[7-benzyl-2-(dimethylamino)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-3-yl]-pyrrolidin-1-ylmethanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155840130) has the molecular formula C27H32F6N4O5 and a molecular weight of 606.56 g/mol. Its IUPAC name is [7-benzyl-2-(dimethylamino)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-3-yl]-pyrrolidin-1-ylmethanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | [7-benzyl-2-(dimethylamino)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-3-yl]-pyrrolidin-1-ylmethanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155840130 |
| Molecular Formula | C27H32F6N4O5 |
| Molecular Weight | 606.56 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | [7-benzyl-2-(dimethylamino)-5,6,8,9-tetrahydropyrido[2,3-d]azepin-3-yl]-pyrrolidin-1-ylmethanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)c1nc2c(cc1C(=O)N1CCCC1)CCN(Cc1ccccc1)CC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H30N4O.2C2HF3O2/c1-25(2)22-20(23(28)27-12-6-7-13-27)16-19-10-14-26(15-11-21(19)24-22)17-18-8-4-3-5-9-18;2*3-2(4,5)1(6)7/h3-5,8-9,16H,6-7,10-15,17H2,1-2H3;2*(H,6,7) |
| InChIKey | VSEAKSQZSCGBPH-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |