C27H34F6N4O6 — CID 155847335
2-(dimethylamino)-7-[(3-methoxyphenyl)methyl]-N-propan-2-yl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155847335) has the molecular formula C27H34F6N4O6 and a molecular weight of 624.58 g/mol. Its IUPAC name is 2-(dimethylamino)-7-[(3-methoxyphenyl)methyl]-N-propan-2-yl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-(dimethylamino)-7-[(3-methoxyphenyl)methyl]-N-propan-2-yl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155847335 |
| Molecular Formula | C27H34F6N4O6 |
| Molecular Weight | 624.58 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | 2-(dimethylamino)-7-[(3-methoxyphenyl)methyl]-N-propan-2-yl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COc1cccc(CN2CCc3cc(C(=O)NC(C)C)c(N(C)C)nc3CC2)c1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H32N4O2.2C2HF3O2/c1-16(2)24-23(28)20-14-18-9-11-27(12-10-21(18)25-22(20)26(3)4)15-17-7-6-8-19(13-17)29-5;2*3-2(4,5)1(6)7/h6-8,13-14,16H,9-12,15H2,1-5H3,(H,24,28);2*(H,6,7) |
| InChIKey | GKTXFMCRGCUELM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 132.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.58 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |