C21H28F6N4O5 — CID 155846843
2-(cyclopropylmethylamino)-N-propan-2-yl-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155846843) has the molecular formula C21H28F6N4O5 and a molecular weight of 530.47 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-N-propan-2-yl-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-(cyclopropylmethylamino)-N-propan-2-yl-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155846843 |
| Molecular Formula | C21H28F6N4O5 |
| Molecular Weight | 530.47 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | 2-(cyclopropylmethylamino)-N-propan-2-yl-6,7,8,9-tetrahydro-5H-pyrido[2,3-d]azepine-3-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CC(C)NC(=O)c1cc2c(nc1NCC1CC1)CCNCC2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N4O.2C2HF3O2/c1-11(2)20-17(22)14-9-13-5-7-18-8-6-15(13)21-16(14)19-10-12-3-4-12;2*3-2(4,5)1(6)7/h9,11-12,18H,3-8,10H2,1-2H3,(H,19,21)(H,20,22);2*(H,6,7) |
| InChIKey | JGSFLWZSBHTEQJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.47 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |