C19H31N5O2 — CID 155901437
7-N-methyl-2-(2-methylpropylamino)-3-N-propan-2-yl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3,7-dicarboxamide (PubChem CID 155901437) has the molecular formula C19H31N5O2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 7-N-methyl-2-(2-methylpropylamino)-3-N-propan-2-yl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3,7-dicarboxamide.
| Compound Name | 7-N-methyl-2-(2-methylpropylamino)-3-N-propan-2-yl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3,7-dicarboxamide |
|---|---|
| PubChem CID | 155901437 |
| Molecular Formula | C19H31N5O2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | 7-N-methyl-2-(2-methylpropylamino)-3-N-propan-2-yl-5,6,8,9-tetrahydropyrido[2,3-d]azepine-3,7-dicarboxamide |
| SMILES | CNC(=O)N1CCc2cc(C(=O)NC(C)C)c(NCC(C)C)nc2CC1 |
| InChI | InChI=1S/C19H31N5O2/c1-12(2)11-21-17-15(18(25)22-13(3)4)10-14-6-8-24(19(26)20-5)9-7-16(14)23-17/h10,12-13H,6-9,11H2,1-5H3,(H,20,26)(H,21,23)(H,22,25) |
| InChIKey | MTSQOCSAMSQLPG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |