C19H25F3N4O4 — CID 155826876
1-[(1R,3aR,7aR)-1-[(pyrimidin-2-ylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-2-cyclopropylethanone;2,2,2-trifluoroacetic acid (PubChem CID 155826876) has the molecular formula C19H25F3N4O4 and a molecular weight of 430.43 g/mol. Its IUPAC name is 1-[(1R,3aR,7aR)-1-[(pyrimidin-2-ylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-2-cyclopropylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[(1R,3aR,7aR)-1-[(pyrimidin-2-ylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-2-cyclopropylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826876 |
| Molecular Formula | C19H25F3N4O4 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 1-[(1R,3aR,7aR)-1-[(pyrimidin-2-ylamino)methyl]-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl]-2-cyclopropylethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(CC1CC1)N1CC[C@@H]2[C@@H](CO[C@H]2CNc2ncccn2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N4O2.C2HF3O2/c22-16(8-12-2-3-12)21-7-4-14-13(10-21)11-23-15(14)9-20-17-18-5-1-6-19-17;3-2(4,5)1(6)7/h1,5-6,12-15H,2-4,7-11H2,(H,18,19,20);(H,6,7)/t13-,14-,15+;/m1./s1 |
| InChIKey | FTRWUSLXKSEEKK-QRWISWEOSA-N |
| XLogP | 2.19 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |