C19H28F3N5O4 — CID 155826949
N-cyclopentyl-2-[(dimethylamino)methyl]-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepine-9-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155826949) has the molecular formula C19H28F3N5O4 and a molecular weight of 447.46 g/mol. Its IUPAC name is N-cyclopentyl-2-[(dimethylamino)methyl]-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepine-9-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-cyclopentyl-2-[(dimethylamino)methyl]-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepine-9-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826949 |
| Molecular Formula | C19H28F3N5O4 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.21 |
| IUPAC Name | N-cyclopentyl-2-[(dimethylamino)methyl]-4-oxo-6,7,8,10-tetrahydropyrimido[1,2-a][1,4]diazepine-9-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)Cc1cc(=O)n2c(n1)CN(C(=O)NC1CCCC1)CCC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H27N5O2.C2HF3O2/c1-20(2)11-14-10-16(23)22-9-5-8-21(12-15(22)18-14)17(24)19-13-6-3-4-7-13;3-2(4,5)1(6)7/h10,13H,3-9,11-12H2,1-2H3,(H,19,24);(H,6,7) |
| InChIKey | BQTUKZZJWBVSBO-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |