C23H32F6N2O7 — CID 155827114
(1R,3aR,7aR)-5-[(5-ethylfuran-2-yl)methyl]-1-(morpholin-4-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155827114) has the molecular formula C23H32F6N2O7 and a molecular weight of 562.50 g/mol. Its IUPAC name is (1R,3aR,7aR)-5-[(5-ethylfuran-2-yl)methyl]-1-(morpholin-4-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (1R,3aR,7aR)-5-[(5-ethylfuran-2-yl)methyl]-1-(morpholin-4-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155827114 |
| Molecular Formula | C23H32F6N2O7 |
| Molecular Weight | 562.50 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | (1R,3aR,7aR)-5-[(5-ethylfuran-2-yl)methyl]-1-(morpholin-4-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCc1ccc(CN2CC[C@@H]3[C@@H](CO[C@H]3CN3CCOCC3)C2)o1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H30N2O3.2C2HF3O2/c1-2-16-3-4-17(24-16)12-21-6-5-18-15(11-21)14-23-19(18)13-20-7-9-22-10-8-20;2*3-2(4,5)1(6)7/h3-4,15,18-19H,2,5-14H2,1H3;2*(H,6,7)/t15-,18-,19+;;/m1../s1 |
| InChIKey | BDAWQADDZQZDTM-YVAMJIDASA-N |
| XLogP | 3.28 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |