C22H27F6N3O7 — CID 155827713
2-[(2S,3aS,6aS)-5-(pyridin-4-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(oxazinan-2-yl)ethanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155827713) has the molecular formula C22H27F6N3O7 and a molecular weight of 559.46 g/mol. Its IUPAC name is 2-[(2S,3aS,6aS)-5-(pyridin-4-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(oxazinan-2-yl)ethanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-[(2S,3aS,6aS)-5-(pyridin-4-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(oxazinan-2-yl)ethanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155827713 |
| Molecular Formula | C22H27F6N3O7 |
| Molecular Weight | 559.46 g/mol |
| Exact Mass | 559.18 |
| IUPAC Name | 2-[(2S,3aS,6aS)-5-(pyridin-4-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-1-(oxazinan-2-yl)ethanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(C[C@@H]1C[C@H]2CN(Cc3ccncc3)C[C@H]2O1)N1CCCCO1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H25N3O3.2C2HF3O2/c22-18(21-7-1-2-8-23-21)10-16-9-15-12-20(13-17(15)24-16)11-14-3-5-19-6-4-14;2*3-2(4,5)1(6)7/h3-6,15-17H,1-2,7-13H2;2*(H,6,7)/t15-,16-,17+;;/m0../s1 |
| InChIKey | FUYAUDOVPJWZSR-PXXDYJNNSA-N |
| XLogP | 2.88 |
| TPSA | 129.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |