C20H25F7N2O5 — CID 155845791
1-[(2R,3aR,6aR)-5-[(4-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N,N-dimethylmethanamine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155845791) has the molecular formula C20H25F7N2O5 and a molecular weight of 506.42 g/mol. Its IUPAC name is 1-[(2R,3aR,6aR)-5-[(4-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N,N-dimethylmethanamine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 1-[(2R,3aR,6aR)-5-[(4-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N,N-dimethylmethanamine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155845791 |
| Molecular Formula | C20H25F7N2O5 |
| Molecular Weight | 506.42 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | 1-[(2R,3aR,6aR)-5-[(4-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N,N-dimethylmethanamine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CN(C)C[C@H]1C[C@@H]2CN(Cc3ccc(F)cc3)C[C@@H]2O1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H23FN2O.2C2HF3O2/c1-18(2)10-15-7-13-9-19(11-16(13)20-15)8-12-3-5-14(17)6-4-12;2*3-2(4,5)1(6)7/h3-6,13,15-16H,7-11H2,1-2H3;2*(H,6,7)/t13-,15-,16+;;/m1../s1 |
| InChIKey | XHELXSSMKOUHJE-PQQLNXCUSA-N |
| XLogP | 3.24 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |