C20H24FN3O2 — CID 97379405
N-[[(2R,3aR,6aR)-5-[(4-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]-1-methylpyrrole-2-carboxamide (PubChem CID 97379405) has the molecular formula C20H24FN3O2 and a molecular weight of 357.43 g/mol. Its IUPAC name is N-[[(2R,3aR,6aR)-5-[(4-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[[(2R,3aR,6aR)-5-[(4-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97379405 |
| Molecular Formula | C20H24FN3O2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | N-[[(2R,3aR,6aR)-5-[(4-fluorophenyl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)NC[C@H]1C[C@@H]2CN(Cc3ccc(F)cc3)C[C@@H]2O1 |
| InChI | InChI=1S/C20H24FN3O2/c1-23-8-2-3-18(23)20(25)22-10-17-9-15-12-24(13-19(15)26-17)11-14-4-6-16(21)7-5-14/h2-8,15,17,19H,9-13H2,1H3,(H,22,25)/t15-,17-,19+/m1/s1 |
| InChIKey | UNEDVUCKKOMRSS-SUMDDJOVSA-N |
| XLogP | 2.18 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |