C18H23N3O3 — CID 97415698
N-[[(2R,3aR,6aR)-5-(furan-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]-1-methylpyrrole-2-carboxamide (PubChem CID 97415698) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[[(2R,3aR,6aR)-5-(furan-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[[(2R,3aR,6aR)-5-(furan-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 97415698 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-[[(2R,3aR,6aR)-5-(furan-3-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cn1cccc1C(=O)NC[C@H]1C[C@@H]2CN(Cc3ccoc3)C[C@@H]2O1 |
| InChI | InChI=1S/C18H23N3O3/c1-20-5-2-3-16(20)18(22)19-8-15-7-14-10-21(11-17(14)24-15)9-13-4-6-23-12-13/h2-6,12,14-15,17H,7-11H2,1H3,(H,19,22)/t14-,15-,17+/m1/s1 |
| InChIKey | FGKJRNNZOUISPR-INMHGKMJSA-N |
| XLogP | 1.64 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |