C17H22N4O2S — CID 124813428
N-[[(2S,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]thiophene-3-carboxamide (PubChem CID 124813428) has the molecular formula C17H22N4O2S and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[[(2S,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]thiophene-3-carboxamide.
| Compound Name | N-[[(2S,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 124813428 |
| Molecular Formula | C17H22N4O2S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-[[(2S,3aS,6aS)-5-[(1-methylpyrazol-4-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]thiophene-3-carboxamide |
| SMILES | Cn1cc(CN2C[C@@H]3C[C@@H](CNC(=O)c4ccsc4)O[C@@H]3C2)cn1 |
| InChI | InChI=1S/C17H22N4O2S/c1-20-7-12(5-19-20)8-21-9-14-4-15(23-16(14)10-21)6-18-17(22)13-2-3-24-11-13/h2-3,5,7,11,14-16H,4,6,8-10H2,1H3,(H,18,22)/t14-,15-,16+/m0/s1 |
| InChIKey | AANVARRETJSOLI-HRCADAONSA-N |
| XLogP | 1.50 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |