C15H15N3OS2 — CID 155800975
N-[2-[5-(1-methylpyrazol-4-yl)thiophen-2-yl]ethyl]thiophene-3-carboxamide (PubChem CID 155800975) has the molecular formula C15H15N3OS2 and a molecular weight of 317.44 g/mol. Its IUPAC name is N-[2-[5-(1-methylpyrazol-4-yl)thiophen-2-yl]ethyl]thiophene-3-carboxamide.
| Compound Name | N-[2-[5-(1-methylpyrazol-4-yl)thiophen-2-yl]ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 155800975 |
| Molecular Formula | C15H15N3OS2 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | N-[2-[5-(1-methylpyrazol-4-yl)thiophen-2-yl]ethyl]thiophene-3-carboxamide |
| SMILES | Cn1cc(-c2ccc(CCNC(=O)c3ccsc3)s2)cn1 |
| InChI | InChI=1S/C15H15N3OS2/c1-18-9-12(8-17-18)14-3-2-13(21-14)4-6-16-15(19)11-5-7-20-10-11/h2-3,5,7-10H,4,6H2,1H3,(H,16,19) |
| InChIKey | TXRXHHDJWKICKV-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |