C17H17N3O2S — CID 155801051
(E)-3-(furan-2-yl)-N-[2-[5-(1-methylpyrazol-4-yl)thiophen-2-yl]ethyl]prop-2-enamide (PubChem CID 155801051) has the molecular formula C17H17N3O2S and a molecular weight of 327.41 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-N-[2-[5-(1-methylpyrazol-4-yl)thiophen-2-yl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-(furan-2-yl)-N-[2-[5-(1-methylpyrazol-4-yl)thiophen-2-yl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 155801051 |
| Molecular Formula | C17H17N3O2S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (E)-3-(furan-2-yl)-N-[2-[5-(1-methylpyrazol-4-yl)thiophen-2-yl]ethyl]prop-2-enamide |
| SMILES | Cn1cc(-c2ccc(CCNC(=O)/C=C/c3ccco3)s2)cn1 |
| InChI | InChI=1S/C17H17N3O2S/c1-20-12-13(11-19-20)16-6-5-15(23-16)8-9-18-17(21)7-4-14-3-2-10-22-14/h2-7,10-12H,8-9H2,1H3,(H,18,21)/b7-4+ |
| InChIKey | RWFAUINTBBDTKO-QPJJXVBHSA-N |
| XLogP | 3.11 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|