C17H15NO2S2 — CID 171137145
3-(furan-2-yl)-N-[2-(5-thiophen-3-ylthiophen-2-yl)ethyl]prop-2-enamide (PubChem CID 171137145) has the molecular formula C17H15NO2S2 and a molecular weight of 329.45 g/mol. Its IUPAC name is 3-(furan-2-yl)-N-[2-(5-thiophen-3-ylthiophen-2-yl)ethyl]prop-2-enamide.
| Compound Name | 3-(furan-2-yl)-N-[2-(5-thiophen-3-ylthiophen-2-yl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 171137145 |
| Molecular Formula | C17H15NO2S2 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.05 |
| IUPAC Name | 3-(furan-2-yl)-N-[2-(5-thiophen-3-ylthiophen-2-yl)ethyl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccco1)NCCc1ccc(-c2ccsc2)s1 |
| InChI | InChI=1S/C17H15NO2S2/c19-17(6-3-14-2-1-10-20-14)18-9-7-15-4-5-16(22-15)13-8-11-21-12-13/h1-6,8,10-12H,7,9H2,(H,18,19) |
| InChIKey | INZWQILGJZJTEP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|