C19H25N3O2S — CID 124816311
N-[[(2S,3aS,6aS)-5-[(5-methylthiophen-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]-1-methylpyrrole-2-carboxamide (PubChem CID 124816311) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is N-[[(2S,3aS,6aS)-5-[(5-methylthiophen-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[[(2S,3aS,6aS)-5-[(5-methylthiophen-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 124816311 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | N-[[(2S,3aS,6aS)-5-[(5-methylthiophen-2-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]methyl]-1-methylpyrrole-2-carboxamide |
| SMILES | Cc1ccc(CN2C[C@@H]3C[C@@H](CNC(=O)c4cccn4C)O[C@@H]3C2)s1 |
| InChI | InChI=1S/C19H25N3O2S/c1-13-5-6-16(25-13)11-22-10-14-8-15(24-18(14)12-22)9-20-19(23)17-4-3-7-21(17)2/h3-7,14-15,18H,8-12H2,1-2H3,(H,20,23)/t14-,15-,18+/m0/s1 |
| InChIKey | IHSPACYYRROGGH-RLFYNMQTSA-N |
| XLogP | 2.41 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |