C21H25F3N2O6 — CID 155847891
2-[(2R,3aS,6aS)-5-(1,3-benzodioxol-5-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-cyclopropylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 155847891) has the molecular formula C21H25F3N2O6 and a molecular weight of 458.43 g/mol. Its IUPAC name is 2-[(2R,3aS,6aS)-5-(1,3-benzodioxol-5-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-cyclopropylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[(2R,3aS,6aS)-5-(1,3-benzodioxol-5-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-cyclopropylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155847891 |
| Molecular Formula | C21H25F3N2O6 |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 2-[(2R,3aS,6aS)-5-(1,3-benzodioxol-5-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-2-yl]-N-cyclopropylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(C[C@H]1C[C@H]2CN(Cc3ccc4c(c3)OCO4)C[C@H]2O1)NC1CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H24N2O4.C2HF3O2/c22-19(20-14-2-3-14)7-15-6-13-9-21(10-18(13)25-15)8-12-1-4-16-17(5-12)24-11-23-16;3-2(4,5)1(6)7/h1,4-5,13-15,18H,2-3,6-11H2,(H,20,22);(H,6,7)/t13-,15+,18+;/m0./s1 |
| InChIKey | MAWQLQKZAJKRKY-CSPYUEOBSA-N |
| XLogP | 2.31 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |