C18H26F3N3O5S — CID 155827993
(4R,4aS,8aR)-N-(2-methoxyethyl)-6-(1,3-thiazol-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155827993) has the molecular formula C18H26F3N3O5S and a molecular weight of 453.48 g/mol. Its IUPAC name is (4R,4aS,8aR)-N-(2-methoxyethyl)-6-(1,3-thiazol-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (4R,4aS,8aR)-N-(2-methoxyethyl)-6-(1,3-thiazol-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155827993 |
| Molecular Formula | C18H26F3N3O5S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | (4R,4aS,8aR)-N-(2-methoxyethyl)-6-(1,3-thiazol-2-ylmethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNC(=O)[C@@H]1CCO[C@@H]2CCN(Cc3nccs3)C[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H25N3O3S.C2HF3O2/c1-21-8-4-18-16(20)12-3-7-22-14-2-6-19(10-13(12)14)11-15-17-5-9-23-15;3-2(4,5)1(6)7/h5,9,12-14H,2-4,6-8,10-11H2,1H3,(H,18,20);(H,6,7)/t12-,13-,14-;/m1./s1 |
| InChIKey | ALGXNOWDQJWUOP-MBLYYGPHSA-N |
| XLogP | 1.77 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|