C17H24F3N3O5S — CID 155828403
(2S,3aS,7aS)-N-(2-methoxyethyl)-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155828403) has the molecular formula C17H24F3N3O5S and a molecular weight of 439.46 g/mol. Its IUPAC name is (2S,3aS,7aS)-N-(2-methoxyethyl)-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (2S,3aS,7aS)-N-(2-methoxyethyl)-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155828403 |
| Molecular Formula | C17H24F3N3O5S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | (2S,3aS,7aS)-N-(2-methoxyethyl)-6-(1,3-thiazol-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | COCCNC(=O)[C@@H]1C[C@@H]2CCN(Cc3nccs3)C[C@H]2O1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N3O3S.C2HF3O2/c1-20-6-3-17-15(19)12-8-11-2-5-18(9-13(11)21-12)10-14-16-4-7-22-14;3-2(4,5)1(6)7/h4,7,11-13H,2-3,5-6,8-10H2,1H3,(H,17,19);(H,6,7)/t11-,12-,13+;/m0./s1 |
| InChIKey | VOKCXSFZARHVFV-GRMSKOJTSA-N |
| XLogP | 1.52 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|