C20H28F6N4O6 — CID 155828988
2-(4-cyclopentylmorpholin-3-yl)-N-(2-methoxyethyl)pyrimidin-4-amine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155828988) has the molecular formula C20H28F6N4O6 and a molecular weight of 534.45 g/mol. Its IUPAC name is 2-(4-cyclopentylmorpholin-3-yl)-N-(2-methoxyethyl)pyrimidin-4-amine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-(4-cyclopentylmorpholin-3-yl)-N-(2-methoxyethyl)pyrimidin-4-amine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155828988 |
| Molecular Formula | C20H28F6N4O6 |
| Molecular Weight | 534.45 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 2-(4-cyclopentylmorpholin-3-yl)-N-(2-methoxyethyl)pyrimidin-4-amine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCCNc1ccnc(C2COCCN2C2CCCC2)n1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H26N4O2.2C2HF3O2/c1-21-10-8-17-15-6-7-18-16(19-15)14-12-22-11-9-20(14)13-4-2-3-5-13;2*3-2(4,5)1(6)7/h6-7,13-14H,2-5,8-12H2,1H3,(H,17,18,19);2*(H,6,7) |
| InChIKey | NNMZNMCETDETAV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 134.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|