C23H24F4N4O2 — CID 155829349
2-[1-(cyclopropylmethyl)piperidin-4-yl]-6-(3-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 155829349) has the molecular formula C23H24F4N4O2 and a molecular weight of 464.46 g/mol. Its IUPAC name is 2-[1-(cyclopropylmethyl)piperidin-4-yl]-6-(3-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[1-(cyclopropylmethyl)piperidin-4-yl]-6-(3-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155829349 |
| Molecular Formula | C23H24F4N4O2 |
| Molecular Weight | 464.46 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | 2-[1-(cyclopropylmethyl)piperidin-4-yl]-6-(3-fluorophenyl)-[1,2,4]triazolo[1,5-a]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | Fc1cccc(-c2ccc3nc(C4CCN(CC5CC5)CC4)nn3c2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H23FN4.C2HF3O2/c22-19-3-1-2-17(12-19)18-6-7-20-23-21(24-26(20)14-18)16-8-10-25(11-9-16)13-15-4-5-15;3-2(4,5)1(6)7/h1-3,6-7,12,14-16H,4-5,8-11,13H2;(H,6,7) |
| InChIKey | JCPAIJHIFJTYPA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 70.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.46 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |