C25H22F3N5O3 — CID 155837546
[4-(6-phenyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)piperidin-1-yl]-pyridin-3-ylmethanone;2,2,2-trifluoroacetic acid (PubChem CID 155837546) has the molecular formula C25H22F3N5O3 and a molecular weight of 497.48 g/mol. Its IUPAC name is [4-(6-phenyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)piperidin-1-yl]-pyridin-3-ylmethanone;2,2,2-trifluoroacetic acid.
| Compound Name | [4-(6-phenyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)piperidin-1-yl]-pyridin-3-ylmethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155837546 |
| Molecular Formula | C25H22F3N5O3 |
| Molecular Weight | 497.48 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | [4-(6-phenyl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)piperidin-1-yl]-pyridin-3-ylmethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1cccnc1)N1CCC(c2nc3ccc(-c4ccccc4)cn3n2)CC1 |
| InChI | InChI=1S/C23H21N5O.C2HF3O2/c29-23(19-7-4-12-24-15-19)27-13-10-18(11-14-27)22-25-21-9-8-20(16-28(21)26-22)17-5-2-1-3-6-17;3-2(4,5)1(6)7/h1-9,12,15-16,18H,10-11,13-14H2;(H,6,7) |
| InChIKey | LBDZPKAKCKFSFW-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 100.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.48 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |