C23H20F3N5O4 — CID 155841042
furan-2-yl-[4-(6-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)piperidin-1-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 155841042) has the molecular formula C23H20F3N5O4 and a molecular weight of 487.44 g/mol. Its IUPAC name is furan-2-yl-[4-(6-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)piperidin-1-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | furan-2-yl-[4-(6-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)piperidin-1-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155841042 |
| Molecular Formula | C23H20F3N5O4 |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 487.15 |
| IUPAC Name | furan-2-yl-[4-(6-pyridin-4-yl-[1,2,4]triazolo[1,5-a]pyridin-2-yl)piperidin-1-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1ccco1)N1CCC(c2nc3ccc(-c4ccncc4)cn3n2)CC1 |
| InChI | InChI=1S/C21H19N5O2.C2HF3O2/c27-21(18-2-1-13-28-18)25-11-7-16(8-12-25)20-23-19-4-3-17(14-26(19)24-20)15-5-9-22-10-6-15;3-2(4,5)1(6)7/h1-6,9-10,13-14,16H,7-8,11-12H2;(H,6,7) |
| InChIKey | NTLLXZCGEWKFGU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 113.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |