C18H27F3N4O4S — CID 155830368
1,1-dimethyl-3-[(5R,9R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-6-oxa-2-azaspiro[4.5]decan-9-yl]urea;2,2,2-trifluoroacetic acid (PubChem CID 155830368) has the molecular formula C18H27F3N4O4S and a molecular weight of 452.50 g/mol. Its IUPAC name is 1,1-dimethyl-3-[(5R,9R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-6-oxa-2-azaspiro[4.5]decan-9-yl]urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1,1-dimethyl-3-[(5R,9R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-6-oxa-2-azaspiro[4.5]decan-9-yl]urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155830368 |
| Molecular Formula | C18H27F3N4O4S |
| Molecular Weight | 452.50 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 1,1-dimethyl-3-[(5R,9R)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-6-oxa-2-azaspiro[4.5]decan-9-yl]urea;2,2,2-trifluoroacetic acid |
| SMILES | Cc1csc(CN2CC[C@@]3(C[C@H](NC(=O)N(C)C)CCO3)C2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H26N4O2S.C2HF3O2/c1-12-10-23-14(17-12)9-20-6-5-16(11-20)8-13(4-7-22-16)18-15(21)19(2)3;3-2(4,5)1(6)7/h10,13H,4-9,11H2,1-3H3,(H,18,21);(H,6,7)/t13-,16-;/m1./s1 |
| InChIKey | CLRLQBYWZOQAAU-OALZAMAHSA-N |
| XLogP | 2.48 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |