C19H29F3N4O4S — CID 155837973
1,1-dimethyl-3-[[(5R,7S)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]urea;2,2,2-trifluoroacetic acid (PubChem CID 155837973) has the molecular formula C19H29F3N4O4S and a molecular weight of 466.53 g/mol. Its IUPAC name is 1,1-dimethyl-3-[[(5R,7S)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]urea;2,2,2-trifluoroacetic acid.
| Compound Name | 1,1-dimethyl-3-[[(5R,7S)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]urea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155837973 |
| Molecular Formula | C19H29F3N4O4S |
| Molecular Weight | 466.53 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | 1,1-dimethyl-3-[[(5R,7S)-2-[(4-methyl-1,3-thiazol-2-yl)methyl]-6-oxa-2-azaspiro[4.5]decan-7-yl]methyl]urea;2,2,2-trifluoroacetic acid |
| SMILES | Cc1csc(CN2CC[C@]3(CCC[C@@H](CNC(=O)N(C)C)O3)C2)n1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H28N4O2S.C2HF3O2/c1-13-11-24-15(19-13)10-21-8-7-17(12-21)6-4-5-14(23-17)9-18-16(22)20(2)3;3-2(4,5)1(6)7/h11,14H,4-10,12H2,1-3H3,(H,18,22);(H,6,7)/t14-,17+;/m0./s1 |
| InChIKey | XTVZZKYNXPCZAE-SQQLFYIASA-N |
| XLogP | 2.87 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |