C22H30F6N4O5S — CID 155830471
9-(cyclopropylmethyl)-1-methyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,9-triazaspiro[5.5]undecan-5-one;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155830471) has the molecular formula C22H30F6N4O5S and a molecular weight of 576.56 g/mol. Its IUPAC name is 9-(cyclopropylmethyl)-1-methyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,9-triazaspiro[5.5]undecan-5-one;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 9-(cyclopropylmethyl)-1-methyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,9-triazaspiro[5.5]undecan-5-one;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155830471 |
| Molecular Formula | C22H30F6N4O5S |
| Molecular Weight | 576.56 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | 9-(cyclopropylmethyl)-1-methyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,9-triazaspiro[5.5]undecan-5-one;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc(CN2CCN(C)C3(CCN(CC4CC4)CC3)C2=O)cs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H28N4OS.2C2HF3O2/c1-14-19-16(13-24-14)12-22-10-9-20(2)18(17(22)23)5-7-21(8-6-18)11-15-3-4-15;2*3-2(4,5)1(6)7/h13,15H,3-12H2,1-2H3;2*(H,6,7) |
| InChIKey | NVZXRXSKTIREHT-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 114.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |