C21H27F9N4O7S — CID 118747161
1,4-dimethyl-9-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,9-triazaspiro[5.5]undecan-5-one;tris(2,2,2-trifluoroacetic acid) (PubChem CID 118747161) has the molecular formula C21H27F9N4O7S and a molecular weight of 650.52 g/mol. Its IUPAC name is 1,4-dimethyl-9-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,9-triazaspiro[5.5]undecan-5-one;tris(2,2,2-trifluoroacetic acid).
| Compound Name | 1,4-dimethyl-9-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,9-triazaspiro[5.5]undecan-5-one;tris(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 118747161 |
| Molecular Formula | C21H27F9N4O7S |
| Molecular Weight | 650.52 g/mol |
| Exact Mass | 650.15 |
| IUPAC Name | 1,4-dimethyl-9-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,9-triazaspiro[5.5]undecan-5-one;tris(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc(CN2CCC3(CC2)C(=O)N(C)CCN3C)cs1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H24N4OS.3C2HF3O2/c1-12-16-13(11-21-12)10-19-6-4-15(5-7-19)14(20)17(2)8-9-18(15)3;3*3-2(4,5)1(6)7/h11H,4-10H2,1-3H3;3*(H,6,7) |
| InChIKey | HZDDHAODJREFIM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 151.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |