C24H27F3N4O6S — CID 155851531
9-(1,3-benzodioxole-5-carbonyl)-4-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,9-triazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155851531) has the molecular formula C24H27F3N4O6S and a molecular weight of 556.56 g/mol. Its IUPAC name is 9-(1,3-benzodioxole-5-carbonyl)-4-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,9-triazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | 9-(1,3-benzodioxole-5-carbonyl)-4-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,9-triazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155851531 |
| Molecular Formula | C24H27F3N4O6S |
| Molecular Weight | 556.56 g/mol |
| Exact Mass | 556.16 |
| IUPAC Name | 9-(1,3-benzodioxole-5-carbonyl)-4-methyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-1,4,9-triazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2CCN(C)C(=O)C23CCN(C(=O)c2ccc4c(c2)OCO4)CC3)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H26N4O4S.C2HF3O2/c1-15-23-17(13-31-15)12-26-10-9-24(2)21(28)22(26)5-7-25(8-6-22)20(27)16-3-4-18-19(11-16)30-14-29-18;3-2(4,5)1(6)7/h3-4,11,13H,5-10,12,14H2,1-2H3;(H,6,7) |
| InChIKey | UXRBUPWZIOYKLU-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 112.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.56 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |