C19H26F3N5O4S — CID 155851498
N-cyclopropyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155851498) has the molecular formula C19H26F3N5O4S and a molecular weight of 477.51 g/mol. Its IUPAC name is N-cyclopropyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-cyclopropyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155851498 |
| Molecular Formula | C19H26F3N5O4S |
| Molecular Weight | 477.51 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | N-cyclopropyl-1-[(2-methyl-1,3-thiazol-4-yl)methyl]-5-oxo-1,4,9-triazaspiro[5.5]undecane-9-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1nc(CN2CCNC(=O)C23CCN(C(=O)NC2CC2)CC3)cs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N5O2S.C2HF3O2/c1-12-19-14(11-25-12)10-22-9-6-18-15(23)17(22)4-7-21(8-5-17)16(24)20-13-2-3-13;3-2(4,5)1(6)7/h11,13H,2-10H2,1H3,(H,18,23)(H,20,24);(H,6,7) |
| InChIKey | XMSUTBIPPBGZMC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 114.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.51 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |