C24H34F3N3O3 — CID 155830825
1-(cyclopropylmethyl)-9-[(3,4-dimethylphenyl)methyl]-4-methyl-1,4,9-triazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid (PubChem CID 155830825) has the molecular formula C24H34F3N3O3 and a molecular weight of 469.55 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-9-[(3,4-dimethylphenyl)methyl]-4-methyl-1,4,9-triazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid.
| Compound Name | 1-(cyclopropylmethyl)-9-[(3,4-dimethylphenyl)methyl]-4-methyl-1,4,9-triazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155830825 |
| Molecular Formula | C24H34F3N3O3 |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | 1-(cyclopropylmethyl)-9-[(3,4-dimethylphenyl)methyl]-4-methyl-1,4,9-triazaspiro[5.5]undecan-5-one;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc(CN2CCC3(CC2)C(=O)N(C)CCN3CC2CC2)cc1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H33N3O.C2HF3O2/c1-17-4-5-20(14-18(17)2)15-24-10-8-22(9-11-24)21(26)23(3)12-13-25(22)16-19-6-7-19;3-2(4,5)1(6)7/h4-5,14,19H,6-13,15-16H2,1-3H3;(H,6,7) |
| InChIKey | JFDLKTLMHJXDIQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |