C21H22F3N5O3S — CID 155832159
1-[7-[(pyridin-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-2-thiophen-2-ylethanone;2,2,2-trifluoroacetic acid (PubChem CID 155832159) has the molecular formula C21H22F3N5O3S and a molecular weight of 481.50 g/mol. Its IUPAC name is 1-[7-[(pyridin-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-2-thiophen-2-ylethanone;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[7-[(pyridin-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-2-thiophen-2-ylethanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155832159 |
| Molecular Formula | C21H22F3N5O3S |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 1-[7-[(pyridin-2-ylamino)methyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-2-thiophen-2-ylethanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Cc1cccs1)N1Cc2ccnn2CC(CNc2ccccn2)C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H21N5OS.C2HF3O2/c25-19(10-17-4-3-9-26-17)23-12-15(11-21-18-5-1-2-7-20-18)13-24-16(14-23)6-8-22-24;3-2(4,5)1(6)7/h1-9,15H,10-14H2,(H,20,21);(H,6,7) |
| InChIKey | JLKIYKONNXALKD-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |