C18H20N6OS — CID 124787566
[(7S)-7-[2-(pyrimidin-2-ylamino)ethyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-thiophen-2-ylmethanone (PubChem CID 124787566) has the molecular formula C18H20N6OS and a molecular weight of 368.47 g/mol. Its IUPAC name is [(7S)-7-[2-(pyrimidin-2-ylamino)ethyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-thiophen-2-ylmethanone.
| Compound Name | [(7S)-7-[2-(pyrimidin-2-ylamino)ethyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 124787566 |
| Molecular Formula | C18H20N6OS |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | [(7S)-7-[2-(pyrimidin-2-ylamino)ethyl]-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1Cc2ccnn2C[C@@H](CCNc2ncccn2)C1 |
| InChI | InChI=1S/C18H20N6OS/c25-17(16-3-1-10-26-16)23-11-14(12-24-15(13-23)5-9-22-24)4-8-21-18-19-6-2-7-20-18/h1-3,5-7,9-10,14H,4,8,11-13H2,(H,19,20,21)/t14-/m0/s1 |
| InChIKey | CUCYYOJUOSOBTK-AWEZNQCLSA-N |
| XLogP | 2.51 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |