C19H26N4OS — CID 124912292
(4,5-dimethylthiophen-2-yl)-[(7S)-7-(pyrrolidin-1-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]methanone (PubChem CID 124912292) has the molecular formula C19H26N4OS and a molecular weight of 358.51 g/mol. Its IUPAC name is (4,5-dimethylthiophen-2-yl)-[(7S)-7-(pyrrolidin-1-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]methanone.
| Compound Name | (4,5-dimethylthiophen-2-yl)-[(7S)-7-(pyrrolidin-1-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]methanone |
|---|---|
| PubChem CID | 124912292 |
| Molecular Formula | C19H26N4OS |
| Molecular Weight | 358.51 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | (4,5-dimethylthiophen-2-yl)-[(7S)-7-(pyrrolidin-1-ylmethyl)-4,6,7,8-tetrahydropyrazolo[1,5-a][1,4]diazepin-5-yl]methanone |
| SMILES | Cc1cc(C(=O)N2Cc3ccnn3C[C@@H](CN3CCCC3)C2)sc1C |
| InChI | InChI=1S/C19H26N4OS/c1-14-9-18(25-15(14)2)19(24)22-11-16(10-21-7-3-4-8-21)12-23-17(13-22)5-6-20-23/h5-6,9,16H,3-4,7-8,10-13H2,1-2H3/t16-/m0/s1 |
| InChIKey | BURMEKYGGPQVRA-INIZCTEOSA-N |
| XLogP | 2.93 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |