C9H18Cl2N2O2 — CID 155834202
(3aR,7aR)-N-methyl-3,4,5,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-3a-carboxamide;dihydrochloride (PubChem CID 155834202) has the molecular formula C9H18Cl2N2O2 and a molecular weight of 257.16 g/mol. Its IUPAC name is (3aR,7aR)-N-methyl-3,4,5,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-3a-carboxamide;dihydrochloride.
| Compound Name | (3aR,7aR)-N-methyl-3,4,5,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-3a-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 155834202 |
| Molecular Formula | C9H18Cl2N2O2 |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | (3aR,7aR)-N-methyl-3,4,5,6,7,7a-hexahydro-2H-furo[3,2-c]pyridine-3a-carboxamide;dihydrochloride |
| SMILES | CNC(=O)[C@@]12CCO[C@@H]1CCNC2.Cl.Cl |
| InChI | InChI=1S/C9H16N2O2.2ClH/c1-10-8(12)9-3-5-13-7(9)2-4-11-6-9;;/h7,11H,2-6H2,1H3,(H,10,12);2*1H/t7-,9-;;/m1../s1 |
| InChIKey | OXAQRVVQCXWIPQ-QRUOIXDJSA-N |
| XLogP | 0.34 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |