C21H31F6N5O6 — CID 155834319
2-ethoxy-1-[6-[(4-methylpiperazin-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]ethanone;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155834319) has the molecular formula C21H31F6N5O6 and a molecular weight of 563.50 g/mol. Its IUPAC name is 2-ethoxy-1-[6-[(4-methylpiperazin-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]ethanone;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 2-ethoxy-1-[6-[(4-methylpiperazin-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]ethanone;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155834319 |
| Molecular Formula | C21H31F6N5O6 |
| Molecular Weight | 563.50 g/mol |
| Exact Mass | 563.22 |
| IUPAC Name | 2-ethoxy-1-[6-[(4-methylpiperazin-1-yl)methyl]-5,6,7,9-tetrahydroimidazo[1,2-a][1,4]diazepin-8-yl]ethanone;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CCOCC(=O)N1Cc2nccn2CC(CN2CCN(C)CC2)C1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H29N5O2.2C2HF3O2/c1-3-24-14-17(23)22-12-15(10-20-8-6-19(2)7-9-20)11-21-5-4-18-16(21)13-22;2*3-2(4,5)1(6)7/h4-5,15H,3,6-14H2,1-2H3;2*(H,6,7) |
| InChIKey | VSOMKYRLKUKTLB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.50 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |