C21H28F6N2O5S — CID 155834845
7-(cyclopropylmethoxy)-2-[(5-methylthiophen-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155834845) has the molecular formula C21H28F6N2O5S and a molecular weight of 534.52 g/mol. Its IUPAC name is 7-(cyclopropylmethoxy)-2-[(5-methylthiophen-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 7-(cyclopropylmethoxy)-2-[(5-methylthiophen-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155834845 |
| Molecular Formula | C21H28F6N2O5S |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 7-(cyclopropylmethoxy)-2-[(5-methylthiophen-2-yl)methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc(CN2CCN3CC(OCC4CC4)CC3C2)s1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H26N2OS.2C2HF3O2/c1-13-2-5-17(21-13)11-18-6-7-19-10-16(8-15(19)9-18)20-12-14-3-4-14;2*3-2(4,5)1(6)7/h2,5,14-16H,3-4,6-12H2,1H3;2*(H,6,7) |
| InChIKey | GLIBJBJXLVBBRT-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |