C20H24F3N5O4 — CID 155836338
[1-(2-methoxyethyl)-8-methyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepin-4-yl]-(5-methylpyrazin-2-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155836338) has the molecular formula C20H24F3N5O4 and a molecular weight of 455.44 g/mol. Its IUPAC name is [1-(2-methoxyethyl)-8-methyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepin-4-yl]-(5-methylpyrazin-2-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [1-(2-methoxyethyl)-8-methyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepin-4-yl]-(5-methylpyrazin-2-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155836338 |
| Molecular Formula | C20H24F3N5O4 |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | [1-(2-methoxyethyl)-8-methyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepin-4-yl]-(5-methylpyrazin-2-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | COCCN1CCN(C(=O)c2cnc(C)cn2)Cc2ccc(C)nc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H23N5O2.C2HF3O2/c1-13-4-5-15-12-23(18(24)16-11-19-14(2)10-20-16)7-6-22(8-9-25-3)17(15)21-13;3-2(4,5)1(6)7/h4-5,10-11H,6-9,12H2,1-3H3;(H,6,7) |
| InChIKey | GSPGZYLAQNVIHN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |