C20H27F6N3O5 — CID 155843508
4-(cyclopropylmethyl)-1-(2-methoxyethyl)-8-methyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155843508) has the molecular formula C20H27F6N3O5 and a molecular weight of 503.44 g/mol. Its IUPAC name is 4-(cyclopropylmethyl)-1-(2-methoxyethyl)-8-methyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-(cyclopropylmethyl)-1-(2-methoxyethyl)-8-methyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155843508 |
| Molecular Formula | C20H27F6N3O5 |
| Molecular Weight | 503.44 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 4-(cyclopropylmethyl)-1-(2-methoxyethyl)-8-methyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COCCN1CCN(CC2CC2)Cc2ccc(C)nc21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H25N3O.2C2HF3O2/c1-13-3-6-15-12-18(11-14-4-5-14)7-8-19(9-10-20-2)16(15)17-13;2*3-2(4,5)1(6)7/h3,6,14H,4-5,7-12H2,1-2H3;2*(H,6,7) |
| InChIKey | XEPOPRXPOLTROE-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |