C22H23F6N3O6 — CID 155827597
4-(1,3-benzodioxol-5-ylmethyl)-1,8-dimethyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155827597) has the molecular formula C22H23F6N3O6 and a molecular weight of 539.43 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-ylmethyl)-1,8-dimethyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-(1,3-benzodioxol-5-ylmethyl)-1,8-dimethyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155827597 |
| Molecular Formula | C22H23F6N3O6 |
| Molecular Weight | 539.43 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | 4-(1,3-benzodioxol-5-ylmethyl)-1,8-dimethyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc2c(n1)N(C)CCN(Cc1ccc3c(c1)OCO3)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H21N3O2.2C2HF3O2/c1-13-3-5-15-11-21(8-7-20(2)18(15)19-13)10-14-4-6-16-17(9-14)23-12-22-16;2*3-2(4,5)1(6)7/h3-6,9H,7-8,10-12H2,1-2H3;2*(H,6,7) |
| InChIKey | MRHTZEFCGXMBSU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 112.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.43 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |