C19H21F6N3O5 — CID 155839614
4-(furan-3-ylmethyl)-1,8-dimethyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155839614) has the molecular formula C19H21F6N3O5 and a molecular weight of 485.38 g/mol. Its IUPAC name is 4-(furan-3-ylmethyl)-1,8-dimethyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 4-(furan-3-ylmethyl)-1,8-dimethyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155839614 |
| Molecular Formula | C19H21F6N3O5 |
| Molecular Weight | 485.38 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | 4-(furan-3-ylmethyl)-1,8-dimethyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1ccc2c(n1)N(C)CCN(Cc1ccoc1)C2.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H19N3O.2C2HF3O2/c1-12-3-4-14-10-18(9-13-5-8-19-11-13)7-6-17(2)15(14)16-12;2*3-2(4,5)1(6)7/h3-5,8,11H,6-7,9-10H2,1-2H3;2*(H,6,7) |
| InChIKey | WDDJJCKTYSPERK-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.38 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |