C19H25F3N4O3 — CID 118743546
N-cyclopropyl-1-(cyclopropylmethyl)-8-methyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 118743546) has the molecular formula C19H25F3N4O3 and a molecular weight of 414.43 g/mol. Its IUPAC name is N-cyclopropyl-1-(cyclopropylmethyl)-8-methyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-cyclopropyl-1-(cyclopropylmethyl)-8-methyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 118743546 |
| Molecular Formula | C19H25F3N4O3 |
| Molecular Weight | 414.43 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | N-cyclopropyl-1-(cyclopropylmethyl)-8-methyl-3,5-dihydro-2H-pyrido[2,3-e][1,4]diazepine-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ccc2c(n1)N(CC1CC1)CCN(C(=O)NC1CC1)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24N4O.C2HF3O2/c1-12-2-5-14-11-21(17(22)19-15-6-7-15)9-8-20(16(14)18-12)10-13-3-4-13;3-2(4,5)1(6)7/h2,5,13,15H,3-4,6-11H2,1H3,(H,19,22);(H,6,7) |
| InChIKey | MYXNWKXTLWWLCW-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |